C23H24BrNO6 — CID 108664018
(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-butyl-5-(3-hydroxy-4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108664018) has the molecular formula C23H24BrNO6 and a molecular weight of 490.35 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-butyl-5-(3-hydroxy-4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-butyl-5-(3-hydroxy-4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108664018 |
| Molecular Formula | C23H24BrNO6 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-butyl-5-(3-hydroxy-4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(\O)c2ccc(OC)c(Br)c2)C1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C23H24BrNO6/c1-4-5-10-25-20(13-6-9-18(31-3)16(26)12-13)19(22(28)23(25)29)21(27)14-7-8-17(30-2)15(24)11-14/h6-9,11-12,20,26-27H,4-5,10H2,1-3H3/b21-19- |
| InChIKey | AYWHSFDSAOMLIA-VZCXRCSSSA-N |
| XLogP | 4.39 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|