C7H10O3 — CID 10866432
(3aS,5S,6aR)-5-hydroxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 10866432) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (3aS,5S,6aR)-5-hydroxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | (3aS,5S,6aR)-5-hydroxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 10866432 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (3aS,5S,6aR)-5-hydroxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | O=C1OC[C@@H]2C[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C7H10O3/c8-5-1-4-3-10-7(9)6(4)2-5/h4-6,8H,1-3H2/t4-,5-,6-/m0/s1 |
| InChIKey | IXWXDERZXOOZPZ-ZLUOBGJFSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |