About [(E)-but-2-enyl] ethyl carbonate
[(E)-but-2-enyl] ethyl carbonate (PubChem CID 10866458) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [(E)-but-2-enyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] ethyl carbonate |
| PubChem CID | 10866458 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(E)-but-2-enyl] ethyl carbonate |
| SMILES | C/C=C/COC(=O)OCC |
| InChI | InChI=1S/C7H12O3/c1-3-5-6-10-7(8)9-4-2/h3,5H,4,6H2,1-2H3/b5-3+ |
| InChIKey | MRBDGJQUEKDXFD-HWKANZROSA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] ethyl carbonate?
The IUPAC name of [(E)-but-2-enyl] ethyl carbonate (CID 10866458) is [(E)-but-2-enyl] ethyl carbonate.
What is the SMILES notation for [(E)-but-2-enyl] ethyl carbonate?
The canonical SMILES for [(E)-but-2-enyl] ethyl carbonate is C/C=C/COC(=O)OCC.
What is the InChIKey of [(E)-but-2-enyl] ethyl carbonate?
The InChIKey is MRBDGJQUEKDXFD-HWKANZROSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-5-6-10-7(8)9-4-2/h3,5H,4,6H2,1-2H3/b5-3+.
What are the key properties of [(E)-but-2-enyl] ethyl carbonate?
[(E)-but-2-enyl] ethyl carbonate has a molecular weight of 144.17 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] ethyl carbonate is sourced from PubChem (CID 10866458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).