About oxiran-2-ylmethyl 2-methylpropanoate
oxiran-2-ylmethyl 2-methylpropanoate (PubChem CID 10866460) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-methylpropanoate |
| PubChem CID | 10866460 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C7H12O3/c1-5(2)7(8)10-4-6-3-9-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | IFYMWMIVKOWLHQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-methylpropanoate?
The IUPAC name of oxiran-2-ylmethyl 2-methylpropanoate (CID 10866460) is oxiran-2-ylmethyl 2-methylpropanoate.
What is the SMILES notation for oxiran-2-ylmethyl 2-methylpropanoate?
The canonical SMILES for oxiran-2-ylmethyl 2-methylpropanoate is CC(C)C(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl 2-methylpropanoate?
The InChIKey is IFYMWMIVKOWLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-5(2)7(8)10-4-6-3-9-6/h5-6H,3-4H2,1-2H3.
What are the key properties of oxiran-2-ylmethyl 2-methylpropanoate?
oxiran-2-ylmethyl 2-methylpropanoate has a molecular weight of 144.17 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-methylpropanoate is sourced from PubChem (CID 10866460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).