C10H12O — CID 10866494
5-methyl-2,3,6,7-tetrahydroinden-1-one (PubChem CID 10866494) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-methyl-2,3,6,7-tetrahydroinden-1-one.
| Compound Name | 5-methyl-2,3,6,7-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 10866494 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 5-methyl-2,3,6,7-tetrahydroinden-1-one |
| SMILES | CC1=CC2=C(CC1)C(=O)CC2 |
| InChI | InChI=1S/C10H12O/c1-7-2-4-9-8(6-7)3-5-10(9)11/h6H,2-5H2,1H3 |
| InChIKey | HHLZYADLHBVKGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |