C25H26ClNO7 — CID 108665144
(4E)-1-butyl-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,3-dione (PubChem CID 108665144) has the molecular formula C25H26ClNO7 and a molecular weight of 487.94 g/mol. Its IUPAC name is (4E)-1-butyl-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-butyl-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108665144 |
| Molecular Formula | C25H26ClNO7 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (4E)-1-butyl-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(/O)c2cc(Cl)c(OC)cc2OC)C1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H26ClNO7/c1-4-5-8-27-22(14-6-7-17-20(11-14)34-10-9-33-17)21(24(29)25(27)30)23(28)15-12-16(26)19(32-3)13-18(15)31-2/h6-7,11-13,22,28H,4-5,8-10H2,1-3H3/b23-21+ |
| InChIKey | HZPJAFFTWKRTRF-XTQSDGFTSA-N |
| XLogP | 4.35 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|