About (S)-(+)-2-Nonen-4-olid
(S)-(+)-2-Nonen-4-olid (PubChem CID 10866553) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is (2S)-2-pentyl-2H-furan-5-one.
Molecular Properties
| Compound Name | (S)-(+)-2-Nonen-4-olid |
| PubChem CID | 10866553 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (2S)-2-pentyl-2H-furan-5-one |
| SMILES | CCCCC[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C9H14O2/c1-2-3-4-5-8-6-7-9(10)11-8/h6-8H,2-5H2,1H3/t8-/m0/s1 |
| InChIKey | MXZSZHJBUODOJK-QMMMGPOBSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | 161 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (S)-(+)-2-Nonen-4-olid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(+)-2-Nonen-4-olid?
The IUPAC name of (S)-(+)-2-Nonen-4-olid (CID 10866553) is (2S)-2-pentyl-2H-furan-5-one.
What is the SMILES notation for (S)-(+)-2-Nonen-4-olid?
The canonical SMILES for (S)-(+)-2-Nonen-4-olid is CCCCC[C@H]1C=CC(=O)O1.
What is the InChIKey of (S)-(+)-2-Nonen-4-olid?
The InChIKey is MXZSZHJBUODOJK-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H14O2/c1-2-3-4-5-8-6-7-9(10)11-8/h6-8H,2-5H2,1H3/t8-/m0/s1.
What are the key properties of (S)-(+)-2-Nonen-4-olid?
(S)-(+)-2-Nonen-4-olid has a molecular weight of 154.21 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(+)-2-Nonen-4-olid is sourced from PubChem (CID 10866553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).