C28H25NO8 — CID 108665573
methyl 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108665573) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is methyl 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108665573 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | methyl 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3cc(OC)ccc3OC)C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H25NO8/c1-34-19-11-7-16(8-12-19)24-23(25(30)21-15-20(35-2)13-14-22(21)36-3)26(31)27(32)29(24)18-9-5-17(6-10-18)28(33)37-4/h5-15,24,30H,1-4H3/b25-23+ |
| InChIKey | ZOSGLXNLGIDFRX-WJTDDFOZSA-N |
| XLogP | 4.13 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|