C30H27NO6 — CID 108665758
2-[4-[(3Z)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 108665758) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[4-[(3Z)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3Z)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 108665758 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-[4-[(3Z)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2c2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H27NO6/c1-37-24-14-10-20(11-15-24)27-26(28(34)22-9-8-19-4-2-3-5-21(19)17-22)29(35)30(36)31(27)23-12-6-18(7-13-23)16-25(32)33/h6-15,17,27,34H,2-5,16H2,1H3,(H,32,33)/b28-26- |
| InChIKey | ZWSFUZOJVHIQDH-SGEDCAFJSA-N |
| XLogP | 4.83 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|