About lithium trimethyl(phenyl)silane
lithium trimethyl(phenyl)silane (PubChem CID 10866585) has the molecular formula C9H13LiSi
and a molecular weight of 156.23 g/mol. Its IUPAC name is lithium trimethyl(phenyl)silane.
Molecular Properties
| Compound Name | lithium trimethyl(phenyl)silane |
| PubChem CID | 10866585 |
| Molecular Formula | C9H13LiSi |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | lithium trimethyl(phenyl)silane |
| SMILES | C[Si](C)(C)c1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C9H13Si.Li/c1-10(2,3)9-7-5-4-6-8-9;/h4-7H,1-3H3;/q-1;+1 |
| InChIKey | JJAYJGNWWDSHFN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium trimethyl(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium trimethyl(phenyl)silane?
The IUPAC name of lithium trimethyl(phenyl)silane (CID 10866585) is lithium trimethyl(phenyl)silane.
What is the SMILES notation for lithium trimethyl(phenyl)silane?
The canonical SMILES for lithium trimethyl(phenyl)silane is C[Si](C)(C)c1[c-]cccc1.[Li+].
What is the InChIKey of lithium trimethyl(phenyl)silane?
The InChIKey is JJAYJGNWWDSHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Si.Li/c1-10(2,3)9-7-5-4-6-8-9;/h4-7H,1-3H3;/q-1;+1.
What are the key properties of lithium trimethyl(phenyl)silane?
lithium trimethyl(phenyl)silane has a molecular weight of 156.23 g/mol, XLogP of -0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium trimethyl(phenyl)silane is sourced from PubChem (CID 10866585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).