C32H33NO4 — CID 108666273
(4Z)-1-(4-tert-butylphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108666273) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (4Z)-1-(4-tert-butylphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(4-tert-butylphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108666273 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (4Z)-1-(4-tert-butylphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(/O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C32H33NO4/c1-32(2,3)24-14-16-25(17-15-24)33-28(22-10-7-11-26(19-22)37-4)27(30(35)31(33)36)29(34)23-13-12-20-8-5-6-9-21(20)18-23/h7,10-19,28,34H,5-6,8-9H2,1-4H3/b29-27- |
| InChIKey | MFNFMUDXDQRWOU-OHYPFYFLSA-N |
| XLogP | 6.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|