C22H21NO6 — CID 108666735
2-[4-[4-hydroxy-2-(3-methoxyphenyl)-5-oxo-3-propanoyl-2H-pyrrol-1-yl]phenyl]acetic acid (PubChem CID 108666735) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[4-[4-hydroxy-2-(3-methoxyphenyl)-5-oxo-3-propanoyl-2H-pyrrol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-hydroxy-2-(3-methoxyphenyl)-5-oxo-3-propanoyl-2H-pyrrol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 108666735 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[4-[4-hydroxy-2-(3-methoxyphenyl)-5-oxo-3-propanoyl-2H-pyrrol-1-yl]phenyl]acetic acid |
| SMILES | CCC(=O)C1=C(O)C(=O)N(c2ccc(CC(=O)O)cc2)C1c1cccc(OC)c1 |
| InChI | InChI=1S/C22H21NO6/c1-3-17(24)19-20(14-5-4-6-16(12-14)29-2)23(22(28)21(19)27)15-9-7-13(8-10-15)11-18(25)26/h4-10,12,20,27H,3,11H2,1-2H3,(H,25,26) |
| InChIKey | FSXOFECHCNYRGT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |