C29H28N2O6 — CID 108666784
N-[4-[(3E)-3-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108666784) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-[4-[(3E)-3-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3E)-3-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108666784 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[4-[(3E)-3-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1cccc(C2/C(=C(\O)c3cc(C)cc(C)c3OC)C(=O)C(=O)N2c2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C29H28N2O6/c1-16-13-17(2)28(37-5)23(14-16)26(33)24-25(19-7-6-8-22(15-19)36-4)31(29(35)27(24)34)21-11-9-20(10-12-21)30-18(3)32/h6-15,25,33H,1-5H3,(H,30,32)/b26-24+ |
| InChIKey | PSERRUMHXIEXOJ-SHHOIMCASA-N |
| XLogP | 4.91 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|