C28H26ClNO6 — CID 108667164
(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108667164) has the molecular formula C28H26ClNO6 and a molecular weight of 507.97 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108667164 |
| Molecular Formula | C28H26ClNO6 |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(N2C(=O)C(=O)/C(=C(/O)c3cc(OC)ccc3Cl)C2c2ccccc2OC)c1 |
| InChI | InChI=1S/C28H26ClNO6/c1-4-14-36-19-9-7-8-17(15-19)30-25(20-10-5-6-11-23(20)35-3)24(27(32)28(30)33)26(31)21-16-18(34-2)12-13-22(21)29/h5-13,15-16,25,31H,4,14H2,1-3H3/b26-24+ |
| InChIKey | FXTNMYCXVFLJOV-SHHOIMCASA-N |
| XLogP | 5.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|