C10H17NO — CID 10866719
(4R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 10866719) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (4R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | (4R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 10866719 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | C[C@@H]1CC(=O)C[C@@H]2CCCCN21 |
| InChI | InChI=1S/C10H17NO/c1-8-6-10(12)7-9-4-2-3-5-11(8)9/h8-9H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | GDQCWCOVKFXWMP-BDAKNGLRSA-N |
| XLogP | 1.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |