About 1-ethyl-3,6-dimethylpyrimidine-2,4-dione
1-ethyl-3,6-dimethylpyrimidine-2,4-dione (PubChem CID 10866731) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-ethyl-3,6-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-ethyl-3,6-dimethylpyrimidine-2,4-dione |
| PubChem CID | 10866731 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-ethyl-3,6-dimethylpyrimidine-2,4-dione |
| SMILES | CCn1c(C)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C8H12N2O2/c1-4-10-6(2)5-7(11)9(3)8(10)12/h5H,4H2,1-3H3 |
| InChIKey | YEMOSDIWPOFYPJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-3,6-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,6-dimethylpyrimidine-2,4-dione?
The IUPAC name of 1-ethyl-3,6-dimethylpyrimidine-2,4-dione (CID 10866731) is 1-ethyl-3,6-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 1-ethyl-3,6-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 1-ethyl-3,6-dimethylpyrimidine-2,4-dione is CCn1c(C)cc(=O)n(C)c1=O.
What is the InChIKey of 1-ethyl-3,6-dimethylpyrimidine-2,4-dione?
The InChIKey is YEMOSDIWPOFYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-10-6(2)5-7(11)9(3)8(10)12/h5H,4H2,1-3H3.
What are the key properties of 1-ethyl-3,6-dimethylpyrimidine-2,4-dione?
1-ethyl-3,6-dimethylpyrimidine-2,4-dione has a molecular weight of 168.20 g/mol, XLogP of -0.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,6-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 10866731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).