About (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol
(3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol (PubChem CID 10866739) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol.
Molecular Properties
| Compound Name | (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol |
| PubChem CID | 10866739 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol |
| SMILES | C#CC[C@@H]([C@@H](O)C=C)C(C)(C)O |
| InChI | InChI=1S/C10H16O2/c1-5-7-8(9(11)6-2)10(3,4)12/h1,6,8-9,11-12H,2,7H2,3-4H3/t8-,9-/m0/s1 |
| InChIKey | COOIBENWGAWQBE-IUCAKERBSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol?
The IUPAC name of (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol (CID 10866739) is (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol.
What is the SMILES notation for (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol?
The canonical SMILES for (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol is C#CC[C@@H]([C@@H](O)C=C)C(C)(C)O.
What is the InChIKey of (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol?
The InChIKey is COOIBENWGAWQBE-IUCAKERBSA-N. The full InChI is InChI=1S/C10H16O2/c1-5-7-8(9(11)6-2)10(3,4)12/h1,6,8-9,11-12H,2,7H2,3-4H3/t8-,9-/m0/s1.
What are the key properties of (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol?
(3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol has a molecular weight of 168.24 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-2-methyl-3-prop-2-ynylhex-5-ene-2,4-diol is sourced from PubChem (CID 10866739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).