C9H18OSi — CID 10866775
(4S,5S)-1,1,5-trimethyl-2-methylidenesilinan-4-ol (PubChem CID 10866775) has the molecular formula C9H18OSi and a molecular weight of 170.33 g/mol. Its IUPAC name is (4S,5S)-1,1,5-trimethyl-2-methylidenesilinan-4-ol.
| Compound Name | (4S,5S)-1,1,5-trimethyl-2-methylidenesilinan-4-ol |
|---|---|
| PubChem CID | 10866775 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (4S,5S)-1,1,5-trimethyl-2-methylidenesilinan-4-ol |
| SMILES | C=C1C[C@H](O)[C@H](C)C[Si]1(C)C |
| InChI | InChI=1S/C9H18OSi/c1-7-6-11(3,4)8(2)5-9(7)10/h7,9-10H,2,5-6H2,1,3-4H3/t7-,9+/m1/s1 |
| InChIKey | WRZJOECLJXWTSZ-APPZFPTMSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|