C9H19NO2 — CID 10866814
(E)-4,4-dimethoxy-N,N,2-trimethylbut-2-en-1-amine (PubChem CID 10866814) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (E)-4,4-dimethoxy-N,N,2-trimethylbut-2-en-1-amine.
| Compound Name | (E)-4,4-dimethoxy-N,N,2-trimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 10866814 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (E)-4,4-dimethoxy-N,N,2-trimethylbut-2-en-1-amine |
| SMILES | COC(/C=C(\C)CN(C)C)OC |
| InChI | InChI=1S/C9H19NO2/c1-8(7-10(2)3)6-9(11-4)12-5/h6,9H,7H2,1-5H3/b8-6+ |
| InChIKey | LCQRBKYYGHPPEH-SOFGYWHQSA-N |
| XLogP | 1.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|