C35H33NO6 — CID 108668302
(4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108668302) has the molecular formula C35H33NO6 and a molecular weight of 563.65 g/mol. Its IUPAC name is (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108668302 |
| Molecular Formula | C35H33NO6 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(/O)c3ccc(OCc4ccccc4)c(C)c3)C(=O)C(=O)N2c2cccc(C)c2)ccc1OC |
| InChI | InChI=1S/C35H33NO6/c1-5-41-30-20-25(14-17-29(30)40-4)32-31(34(38)35(39)36(32)27-13-9-10-22(2)18-27)33(37)26-15-16-28(23(3)19-26)42-21-24-11-7-6-8-12-24/h6-20,32,37H,5,21H2,1-4H3/b33-31- |
| InChIKey | VAMRKEJAMQEZEX-FPODKLOTSA-N |
| XLogP | 6.92 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|