C26H22ClNO7 — CID 108668954
(4E)-1-(3-chloro-4-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108668954) has the molecular formula C26H22ClNO7 and a molecular weight of 495.92 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-4-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108668954 |
| Molecular Formula | C26H22ClNO7 |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (4E)-1-(3-chloro-4-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OC)c(OC)c3)C2c2ccc(O)cc2)cc1Cl |
| InChI | InChI=1S/C26H22ClNO7/c1-33-19-11-7-16(13-18(19)27)28-23(14-4-8-17(29)9-5-14)22(25(31)26(28)32)24(30)15-6-10-20(34-2)21(12-15)35-3/h4-13,23,29-30H,1-3H3/b24-22+ |
| InChIKey | USOVDTVGFAUUMM-ZNTNEXAZSA-N |
| XLogP | 4.70 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|