C11H14O2 — CID 10866907
(5R,6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulene-5,6-diol (PubChem CID 10866907) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (5R,6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulene-5,6-diol.
| Compound Name | (5R,6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulene-5,6-diol |
|---|---|
| PubChem CID | 10866907 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (5R,6S)-6,7,8,9-tetrahydro-5H-benzo[7]annulene-5,6-diol |
| SMILES | O[C@@H]1c2ccccc2CCC[C@@H]1O |
| InChI | InChI=1S/C11H14O2/c12-10-7-3-5-8-4-1-2-6-9(8)11(10)13/h1-2,4,6,10-13H,3,5,7H2/t10-,11+/m0/s1 |
| InChIKey | QGVXNVFNLXEOHJ-WDEREUQCSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |