C12H21N — CID 10866930
N,N,2-trimethyl-6-methylideneocta-1,7-dien-3-amine (PubChem CID 10866930) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N,2-trimethyl-6-methylideneocta-1,7-dien-3-amine.
| Compound Name | N,N,2-trimethyl-6-methylideneocta-1,7-dien-3-amine |
|---|---|
| PubChem CID | 10866930 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,N,2-trimethyl-6-methylideneocta-1,7-dien-3-amine |
| SMILES | C=CC(=C)CCC(C(=C)C)N(C)C |
| InChI | InChI=1S/C12H21N/c1-7-11(4)8-9-12(10(2)3)13(5)6/h7,12H,1-2,4,8-9H2,3,5-6H3 |
| InChIKey | HPLZBYCQZNUSTG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|