C31H28N2O5 — CID 108669873
4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)-2H-pyrrol-5-one (PubChem CID 108669873) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108669873 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(3-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)-2H-pyrrol-5-one |
| SMILES | COc1cccc2cc(C(=O)C3=C(O)C(=O)N(c4ccc(N5CCCC5)cc4)C3c3cccc(C)c3)oc12 |
| InChI | InChI=1S/C31H28N2O5/c1-19-7-5-8-20(17-19)27-26(28(34)25-18-21-9-6-10-24(37-2)30(21)38-25)29(35)31(36)33(27)23-13-11-22(12-14-23)32-15-3-4-16-32/h5-14,17-18,27,35H,3-4,15-16H2,1-2H3 |
| InChIKey | WBUQAGXPYWTANH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|