C30H28N2O3 — CID 108670870
4-[(3E)-2-(4-tert-butylphenyl)-3-[(2,5-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108670870) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[(3E)-2-(4-tert-butylphenyl)-3-[(2,5-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-2-(4-tert-butylphenyl)-3-[(2,5-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108670870 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[(3E)-2-(4-tert-butylphenyl)-3-[(2,5-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1ccc(C)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H28N2O3/c1-18-6-7-19(2)24(16-18)27(33)25-26(21-10-12-22(13-11-21)30(3,4)5)32(29(35)28(25)34)23-14-8-20(17-31)9-15-23/h6-16,26,33H,1-5H3/b27-25+ |
| InChIKey | IIVUZAJIERFILC-IMVLJIQESA-N |
| XLogP | 6.10 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|