C23H20N2O6S2 — CID 108671774
4-[(4Z)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108671774) has the molecular formula C23H20N2O6S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4Z)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108671774 |
| Molecular Formula | C23H20N2O6S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2c2cccs2)cc1C |
| InChI | InChI=1S/C23H20N2O6S2/c1-13-12-14(5-10-17(13)31-2)21(26)19-20(18-4-3-11-32-18)25(23(28)22(19)27)15-6-8-16(9-7-15)33(24,29)30/h3-12,20,26H,1-2H3,(H2,24,29,30)/b21-19- |
| InChIKey | NCLDMKABNHZESK-VZCXRCSSSA-N |
| XLogP | 3.34 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|