C25H18ClF3N2O5 — CID 108672069
(4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-pyridin-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108672069) has the molecular formula C25H18ClF3N2O5 and a molecular weight of 518.88 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-pyridin-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-pyridin-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108672069 |
| Molecular Formula | C25H18ClF3N2O5 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-pyridin-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(OC(F)(F)F)cc3)C2c2ccccn2)c1 |
| InChI | InChI=1S/C25H18ClF3N2O5/c1-2-35-16-10-11-18(26)17(13-16)22(32)20-21(19-5-3-4-12-30-19)31(24(34)23(20)33)14-6-8-15(9-7-14)36-25(27,28)29/h3-13,21,32H,2H2,1H3/b22-20+ |
| InChIKey | GXABSTUYZXGJKY-LSDHQDQOSA-N |
| XLogP | 5.66 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|