C25H23N3O4 — CID 108672205
3-(furan-2-carbonyl)-4-hydroxy-1-(4-piperidin-1-ylphenyl)-2-pyridin-2-yl-2H-pyrrol-5-one (PubChem CID 108672205) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-1-(4-piperidin-1-ylphenyl)-2-pyridin-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-1-(4-piperidin-1-ylphenyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108672205 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-1-(4-piperidin-1-ylphenyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2ccc(N3CCCCC3)cc2)C1c1ccccn1)c1ccco1 |
| InChI | InChI=1S/C25H23N3O4/c29-23(20-8-6-16-32-20)21-22(19-7-2-3-13-26-19)28(25(31)24(21)30)18-11-9-17(10-12-18)27-14-4-1-5-15-27/h2-3,6-13,16,22,30H,1,4-5,14-15H2 |
| InChIKey | BSZHMXCYEYRNGG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|