C28H26N2O7 — CID 108672335
propan-2-yl 4-[(4E)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate (PubChem CID 108672335) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is propan-2-yl 4-[(4E)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate.
| Compound Name | propan-2-yl 4-[(4E)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108672335 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | propan-2-yl 4-[(4E)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(OC)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(C(=O)OC(C)C)cc3)C2c2ccccn2)c1 |
| InChI | InChI=1S/C28H26N2O7/c1-16(2)37-28(34)17-8-10-18(11-9-17)30-24(21-7-5-6-14-29-21)23(26(32)27(30)33)25(31)20-15-19(35-3)12-13-22(20)36-4/h5-16,24,31H,1-4H3/b25-23+ |
| InChIKey | AXCQWPIMDLUQPA-WJTDDFOZSA-N |
| XLogP | 4.29 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|