About 2-amino-4,5-dimethoxybenzamide
2-amino-4,5-dimethoxybenzamide (PubChem CID 10867236) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethoxybenzamide |
| PubChem CID | 10867236 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C9H12N2O3/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H2,11,12) |
| InChIKey | RLWBNRZPIQCPFT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethoxybenzamide?
The IUPAC name of 2-amino-4,5-dimethoxybenzamide (CID 10867236) is 2-amino-4,5-dimethoxybenzamide.
What is the SMILES notation for 2-amino-4,5-dimethoxybenzamide?
The canonical SMILES for 2-amino-4,5-dimethoxybenzamide is COc1cc(N)c(C(N)=O)cc1OC.
What is the InChIKey of 2-amino-4,5-dimethoxybenzamide?
The InChIKey is RLWBNRZPIQCPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H2,11,12).
What are the key properties of 2-amino-4,5-dimethoxybenzamide?
2-amino-4,5-dimethoxybenzamide has a molecular weight of 196.21 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethoxybenzamide is sourced from PubChem (CID 10867236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).