About (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one
(6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one (PubChem CID 10867334) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one.
Molecular Properties
| Compound Name | (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one |
| PubChem CID | 10867334 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one |
| SMILES | O=C1CCC[C@H]([C@@H]2C[C@H]2[C@H](O)CO)O1 |
| InChI | InChI=1S/C10H16O4/c11-5-8(12)6-4-7(6)9-2-1-3-10(13)14-9/h6-9,11-12H,1-5H2/t6-,7-,8-,9-/m1/s1 |
| InChIKey | QLKJFQQEBKYJCO-FNCVBFRFSA-N |
| XLogP | 0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one?
The IUPAC name of (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one (CID 10867334) is (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one.
What is the SMILES notation for (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one?
The canonical SMILES for (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one is O=C1CCC[C@H]([C@@H]2C[C@H]2[C@H](O)CO)O1.
What is the InChIKey of (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one?
The InChIKey is QLKJFQQEBKYJCO-FNCVBFRFSA-N. The full InChI is InChI=1S/C10H16O4/c11-5-8(12)6-4-7(6)9-2-1-3-10(13)14-9/h6-9,11-12H,1-5H2/t6-,7-,8-,9-/m1/s1.
What are the key properties of (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one?
(6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one has a molecular weight of 200.23 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-[(1R,2R)-2-[(1S)-1,2-dihydroxyethyl]cyclopropyl]oxan-2-one is sourced from PubChem (CID 10867334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).