About 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone
1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone (PubChem CID 10867387) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone |
| PubChem CID | 10867387 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone |
| SMILES | CC(=O)C1(C)CNC(=S)NC1(C)O |
| InChI | InChI=1S/C8H14N2O2S/c1-5(11)7(2)4-9-6(13)10-8(7,3)12/h12H,4H2,1-3H3,(H2,9,10,13) |
| InChIKey | RRTKIVNOJONSAV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone?
The IUPAC name of 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone (CID 10867387) is 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone.
What is the SMILES notation for 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone?
The canonical SMILES for 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone is CC(=O)C1(C)CNC(=S)NC1(C)O.
What is the InChIKey of 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone?
The InChIKey is RRTKIVNOJONSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-5(11)7(2)4-9-6(13)10-8(7,3)12/h12H,4H2,1-3H3,(H2,9,10,13).
What are the key properties of 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone?
1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone has a molecular weight of 202.28 g/mol, XLogP of -0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-4,5-dimethyl-2-sulfanylidene-1,3-diazinan-5-yl)ethanone is sourced from PubChem (CID 10867387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).