About (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine
(2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 1086746) has the molecular formula C17H27NO2S
and a molecular weight of 309.48 g/mol. Its IUPAC name is (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine |
| PubChem CID | 1086746 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2S/c1-13-7-6-8-14(2)18(13)21(19,20)16-11-9-15(10-12-16)17(3,4)5/h9-14H,6-8H2,1-5H3/t13-,14+ |
| InChIKey | HOUVPLOZMHLJPB-OKILXGFUSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine?
The IUPAC name of (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine (CID 1086746) is (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine.
What is the SMILES notation for (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine?
The canonical SMILES for (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine is C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine?
The InChIKey is HOUVPLOZMHLJPB-OKILXGFUSA-N. The full InChI is InChI=1S/C17H27NO2S/c1-13-7-6-8-14(2)18(13)21(19,20)16-11-9-15(10-12-16)17(3,4)5/h9-14H,6-8H2,1-5H3/t13-,14+.
What are the key properties of (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine?
(2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine has a molecular weight of 309.48 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-1-(4-tert-butylphenyl)sulfonyl-2,6-dimethylpiperidine is sourced from PubChem (CID 1086746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).