About 4-tert-butyl-1,1-dichlorocyclohexane
4-tert-butyl-1,1-dichlorocyclohexane (PubChem CID 10867528) has the molecular formula C10H18Cl2
and a molecular weight of 209.16 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dichlorocyclohexane.
Molecular Properties
| Compound Name | 4-tert-butyl-1,1-dichlorocyclohexane |
| PubChem CID | 10867528 |
| Molecular Formula | C10H18Cl2 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-tert-butyl-1,1-dichlorocyclohexane |
| SMILES | CC(C)(C)C1CCC(Cl)(Cl)CC1 |
| InChI | InChI=1S/C10H18Cl2/c1-9(2,3)8-4-6-10(11,12)7-5-8/h8H,4-7H2,1-3H3 |
| InChIKey | DCXRJOJENNDVRN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,1-dichlorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,1-dichlorocyclohexane?
The IUPAC name of 4-tert-butyl-1,1-dichlorocyclohexane (CID 10867528) is 4-tert-butyl-1,1-dichlorocyclohexane.
What is the SMILES notation for 4-tert-butyl-1,1-dichlorocyclohexane?
The canonical SMILES for 4-tert-butyl-1,1-dichlorocyclohexane is CC(C)(C)C1CCC(Cl)(Cl)CC1.
What is the InChIKey of 4-tert-butyl-1,1-dichlorocyclohexane?
The InChIKey is DCXRJOJENNDVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Cl2/c1-9(2,3)8-4-6-10(11,12)7-5-8/h8H,4-7H2,1-3H3.
What are the key properties of 4-tert-butyl-1,1-dichlorocyclohexane?
4-tert-butyl-1,1-dichlorocyclohexane has a molecular weight of 209.16 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,1-dichlorocyclohexane is sourced from PubChem (CID 10867528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).