C28H18F3NO3 — CID 108677233
(4Z)-1-(3,4-difluorophenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 108677233) has the molecular formula C28H18F3NO3 and a molecular weight of 473.45 g/mol. Its IUPAC name is (4Z)-1-(3,4-difluorophenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3,4-difluorophenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108677233 |
| Molecular Formula | C28H18F3NO3 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (4Z)-1-(3,4-difluorophenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(F)c(F)c3)C2c2cccc3ccccc23)ccc1F |
| InChI | InChI=1S/C28H18F3NO3/c1-15-13-17(9-11-21(15)29)26(33)24-25(20-8-4-6-16-5-2-3-7-19(16)20)32(28(35)27(24)34)18-10-12-22(30)23(31)14-18/h2-14,25,33H,1H3/b26-24- |
| InChIKey | UGFOYYNOPMZKBJ-LCUIJRPUSA-N |
| XLogP | 6.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|