C29H21Cl2NO5 — CID 108677307
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 108677307) has the molecular formula C29H21Cl2NO5 and a molecular weight of 534.40 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108677307 |
| Molecular Formula | C29H21Cl2NO5 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3)C2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H21Cl2NO5/c1-36-19-12-10-18(11-13-19)32-25(21-9-5-7-16-6-3-4-8-20(16)21)24(27(34)29(32)35)26(33)17-14-22(30)28(37-2)23(31)15-17/h3-15,25,33H,1-2H3/b26-24+ |
| InChIKey | ICDSGDGKMUTGIE-SHHOIMCASA-N |
| XLogP | 6.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|