C32H29N3O3S — CID 108677794
4-hydroxy-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2-phenyl-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-5-one (PubChem CID 108677794) has the molecular formula C32H29N3O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is 4-hydroxy-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2-phenyl-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2-phenyl-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108677794 |
| Molecular Formula | C32H29N3O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 4-hydroxy-3-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2-phenyl-1-(4-piperidin-1-ylphenyl)-2H-pyrrol-5-one |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)C1=C(O)C(=O)N(c2ccc(N3CCCCC3)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C32H29N3O3S/c1-21-30(39-31(33-21)23-13-7-3-8-14-23)28(36)26-27(22-11-5-2-6-12-22)35(32(38)29(26)37)25-17-15-24(16-18-25)34-19-9-4-10-20-34/h2-3,5-8,11-18,27,37H,4,9-10,19-20H2,1H3 |
| InChIKey | CGSZDLPXLKJAGK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|