C30H29NO6 — CID 108678159
propyl 3-[(4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate (PubChem CID 108678159) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is propyl 3-[(4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108678159 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | propyl 3-[(4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3cccc(OCCC)c3)C2c2ccccc2)c1 |
| InChI | InChI=1S/C30H29NO6/c1-3-16-36-24-15-9-12-21(19-24)27(32)25-26(20-10-6-5-7-11-20)31(29(34)28(25)33)23-14-8-13-22(18-23)30(35)37-17-4-2/h5-15,18-19,26,32H,3-4,16-17H2,1-2H3/b27-25+ |
| InChIKey | WKSRUBGJGUKTCM-IMVLJIQESA-N |
| XLogP | 5.67 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|