C28H28N2O6S — CID 108678412
4-[(4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108678412) has the molecular formula C28H28N2O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is 4-[(4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108678412 |
| Molecular Formula | C28H28N2O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[(4E)-4-[(5-tert-butyl-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(C(C)(C)C)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C28H28N2O6S/c1-28(2,3)18-10-15-22(36-4)21(16-18)25(31)23-24(17-8-6-5-7-9-17)30(27(33)26(23)32)19-11-13-20(14-12-19)37(29,34)35/h5-16,24,31H,1-4H3,(H2,29,34,35)/b25-23+ |
| InChIKey | QULRNXZBLOPLOZ-WJTDDFOZSA-N |
| XLogP | 4.27 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|