C14H26N2 — CID 10867899
(2S,7R,9R)-7-propyl-1,6-diazatricyclo[7.4.0.02,6]tridecane (PubChem CID 10867899) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2S,7R,9R)-7-propyl-1,6-diazatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (2S,7R,9R)-7-propyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 10867899 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2S,7R,9R)-7-propyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCC[C@@H]1C[C@H]2CCCCN2[C@H]2CCCN12 |
| InChI | InChI=1S/C14H26N2/c1-2-6-12-11-13-7-3-4-9-15(13)14-8-5-10-16(12)14/h12-14H,2-11H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | LYCOMYYBFDXJFS-MGPQQGTHSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |