About 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane
2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 10867900) has the molecular formula C13H22OSi
and a molecular weight of 222.40 g/mol. Its IUPAC name is 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane |
| PubChem CID | 10867900 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#C[C@@H]1O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H22OSi/c1-15(2,3)10-9-12-13(14-12)11-7-5-4-6-8-11/h11-13H,4-8H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | ZOIDITARUBXFRP-QWHCGFSZSA-N |
| XLogP | 3.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane?
The IUPAC name of 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane (CID 10867900) is 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane is C[Si](C)(C)C#C[C@@H]1O[C@@H]1C1CCCCC1.
What is the InChIKey of 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane?
The InChIKey is ZOIDITARUBXFRP-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H22OSi/c1-15(2,3)10-9-12-13(14-12)11-7-5-4-6-8-11/h11-13H,4-8H2,1-3H3/t12-,13+/m0/s1.
What are the key properties of 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane?
2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane has a molecular weight of 222.40 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethynyl-trimethylsilane is sourced from PubChem (CID 10867900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).