About (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine
(E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine (PubChem CID 10867913) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| PubChem CID | 10867913 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| SMILES | COc1nccc(/C=C/N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O3/c1-12(2)7-5-8-4-6-11-10(16-3)9(8)13(14)15/h4-7H,1-3H3/b7-5+ |
| InChIKey | JUMZKSSQQBQUDE-FNORWQNLSA-N |
| XLogP | 1.53 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The IUPAC name of (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine (CID 10867913) is (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine.
What is the SMILES notation for (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The canonical SMILES for (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine is COc1nccc(/C=C/N(C)C)c1[N+](=O)[O-].
What is the InChIKey of (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The InChIKey is JUMZKSSQQBQUDE-FNORWQNLSA-N. The full InChI is InChI=1S/C10H13N3O3/c1-12(2)7-5-8-4-6-11-10(16-3)9(8)13(14)15/h4-7H,1-3H3/b7-5+.
What are the key properties of (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine?
(E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine has a molecular weight of 223.23 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine is sourced from PubChem (CID 10867913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).