About [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol
[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol (PubChem CID 10867918) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol.
Molecular Properties
| Compound Name | [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol |
| PubChem CID | 10867918 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol |
| SMILES | COc1ccc(C2=NOC(CS)C2)cc1 |
| InChI | InChI=1S/C11H13NO2S/c1-13-9-4-2-8(3-5-9)11-6-10(7-15)14-12-11/h2-5,10,15H,6-7H2,1H3 |
| InChIKey | NYXKUMCURCSMDL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol?
The IUPAC name of [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol (CID 10867918) is [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol.
What is the SMILES notation for [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol?
The canonical SMILES for [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol is COc1ccc(C2=NOC(CS)C2)cc1.
What is the InChIKey of [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol?
The InChIKey is NYXKUMCURCSMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c1-13-9-4-2-8(3-5-9)11-6-10(7-15)14-12-11/h2-5,10,15H,6-7H2,1H3.
What are the key properties of [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol?
[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol has a molecular weight of 223.30 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanethiol is sourced from PubChem (CID 10867918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).