C28H19Cl2NO3 — CID 108680282
(4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108680282) has the molecular formula C28H19Cl2NO3 and a molecular weight of 488.37 g/mol. Its IUPAC name is (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680282 |
| Molecular Formula | C28H19Cl2NO3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4ccccc4c3)C2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H19Cl2NO3/c1-16-6-11-21(12-7-16)31-25(19-10-13-22(29)23(30)15-19)24(27(33)28(31)34)26(32)20-9-8-17-4-2-3-5-18(17)14-20/h2-15,25,32H,1H3/b26-24- |
| InChIKey | JDTOAQUUFHEAOK-LCUIJRPUSA-N |
| XLogP | 7.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|