About 1,8-dioxacyclotetradecane-2,9-dione
1,8-dioxacyclotetradecane-2,9-dione (PubChem CID 10868051) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,8-dioxacyclotetradecane-2,9-dione.
Molecular Properties
| Compound Name | 1,8-dioxacyclotetradecane-2,9-dione |
| PubChem CID | 10868051 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1,8-dioxacyclotetradecane-2,9-dione |
| SMILES | O=C1CCCCCOC(=O)CCCCCO1 |
| InChI | InChI=1S/C12H20O4/c13-11-7-3-1-5-9-15-12(14)8-4-2-6-10-16-11/h1-10H2 |
| InChIKey | NUTDOUGNQAMWBU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,8-dioxacyclotetradecane-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dioxacyclotetradecane-2,9-dione?
The IUPAC name of 1,8-dioxacyclotetradecane-2,9-dione (CID 10868051) is 1,8-dioxacyclotetradecane-2,9-dione.
What is the SMILES notation for 1,8-dioxacyclotetradecane-2,9-dione?
The canonical SMILES for 1,8-dioxacyclotetradecane-2,9-dione is O=C1CCCCCOC(=O)CCCCCO1.
What is the InChIKey of 1,8-dioxacyclotetradecane-2,9-dione?
The InChIKey is NUTDOUGNQAMWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c13-11-7-3-1-5-9-15-12(14)8-4-2-6-10-16-11/h1-10H2.
What are the key properties of 1,8-dioxacyclotetradecane-2,9-dione?
1,8-dioxacyclotetradecane-2,9-dione has a molecular weight of 228.29 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dioxacyclotetradecane-2,9-dione is sourced from PubChem (CID 10868051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).