C29H26N2O5 — CID 108680885
(4E)-1-(3-ethoxyphenyl)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108680885) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is (4E)-1-(3-ethoxyphenyl)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-ethoxyphenyl)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680885 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (4E)-1-(3-ethoxyphenyl)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OC)c(C)c3)C2c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C29H26N2O5/c1-4-36-20-9-7-8-19(15-20)31-26(22-16-30-23-11-6-5-10-21(22)23)25(28(33)29(31)34)27(32)18-12-13-24(35-3)17(2)14-18/h5-16,26,30,32H,4H2,1-3H3/b27-25+ |
| InChIKey | FKRMWYQVXVDUOY-IMVLJIQESA-N |
| XLogP | 5.51 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|