C33H34N2O4 — CID 108681045
(4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1H-indol-3-yl)-1-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 108681045) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1H-indol-3-yl)-1-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1H-indol-3-yl)-1-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108681045 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1H-indol-3-yl)-1-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(C(C)C)cc3)C2c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C33H34N2O4/c1-4-5-8-19-39-25-17-13-23(14-18-25)31(36)29-30(27-20-34-28-10-7-6-9-26(27)28)35(33(38)32(29)37)24-15-11-22(12-16-24)21(2)3/h6-7,9-18,20-21,30,34,36H,4-5,8,19H2,1-3H3/b31-29+ |
| InChIKey | ZPWYEYUMCYPHSX-OWWNRXNESA-N |
| XLogP | 7.49 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|