C28H23ClN2O3 — CID 108681279
(4E)-1-(3-chloro-4-methylphenyl)-4-[(4-ethylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108681279) has the molecular formula C28H23ClN2O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-methylphenyl)-4-[(4-ethylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-4-methylphenyl)-4-[(4-ethylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108681279 |
| Molecular Formula | C28H23ClN2O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (4E)-1-(3-chloro-4-methylphenyl)-4-[(4-ethylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(C)c(Cl)c3)C2c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H23ClN2O3/c1-3-17-9-11-18(12-10-17)26(32)24-25(21-15-30-23-7-5-4-6-20(21)23)31(28(34)27(24)33)19-13-8-16(2)22(29)14-19/h4-15,25,30,32H,3H2,1-2H3/b26-24+ |
| InChIKey | CJACQUNDTIPTRU-SHHOIMCASA-N |
| XLogP | 6.32 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|