C23H14BrCl2NO4 — CID 108681726
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3,4-dichlorophenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108681726) has the molecular formula C23H14BrCl2NO4 and a molecular weight of 519.18 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3,4-dichlorophenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3,4-dichlorophenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108681726 |
| Molecular Formula | C23H14BrCl2NO4 |
| Molecular Weight | 519.18 g/mol |
| Exact Mass | 516.95 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3,4-dichlorophenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(Cl)c(Cl)c2)C(c2cccc(O)c2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H14BrCl2NO4/c24-14-6-4-12(5-7-14)21(29)19-20(13-2-1-3-16(28)10-13)27(23(31)22(19)30)15-8-9-17(25)18(26)11-15/h1-11,20,28-29H/b21-19+ |
| InChIKey | DNMVJYOEQDUDBD-XUTLUUPISA-N |
| XLogP | 6.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.18 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|