C15H23NO — CID 10868206
4-[(1R,6S)-2-(ethenoxymethyl)-1,6-dimethylcyclohex-2-en-1-yl]butanenitrile (PubChem CID 10868206) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-[(1R,6S)-2-(ethenoxymethyl)-1,6-dimethylcyclohex-2-en-1-yl]butanenitrile.
| Compound Name | 4-[(1R,6S)-2-(ethenoxymethyl)-1,6-dimethylcyclohex-2-en-1-yl]butanenitrile |
|---|---|
| PubChem CID | 10868206 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-[(1R,6S)-2-(ethenoxymethyl)-1,6-dimethylcyclohex-2-en-1-yl]butanenitrile |
| SMILES | C=COCC1=CCC[C@H](C)[C@@]1(C)CCCC#N |
| InChI | InChI=1S/C15H23NO/c1-4-17-12-14-9-7-8-13(2)15(14,3)10-5-6-11-16/h4,9,13H,1,5-8,10,12H2,2-3H3/t13-,15+/m0/s1 |
| InChIKey | BRRGSNDWVITSMG-DZGCQCFKSA-N |
| XLogP | 4.20 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|